N-Cbz-D-glutamic acid α-benzyl ester structure
|
Common Name | N-Cbz-D-glutamic acid α-benzyl ester | ||
|---|---|---|---|---|
| CAS Number | 65706-99-2 | Molecular Weight | 371.384 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 594.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H21NO6 | Melting Point | 100 °C | |
| MSDS | USA | Flash Point | 313.2±30.1 °C | |
Use of N-Cbz-D-glutamic acid α-benzyl esterZ-D-Glu-Obzl is a derivative of D-Glu, can be used for synthesis of compounds[1]. |
| Name | N-Cbz-D-glutamic acid α-benzyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | Z-D-Glu-Obzl is a derivative of D-Glu, can be used for synthesis of compounds[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 594.3±50.0 °C at 760 mmHg |
| Melting Point | 100 °C |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.384 |
| Flash Point | 313.2±30.1 °C |
| Exact Mass | 371.136902 |
| PSA | 101.93000 |
| LogP | 4.05 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | VWHKODOUMSMUAF-QGZVFWFLSA-N |
| SMILES | O=C(O)CCC(NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| Storage condition | −20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
|
~%
N-Cbz-D-glutami... CAS#:65706-99-2 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 1187 - 1192 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Z-L-Glu-OBzl |
| CBZ-D-GLU-OBZL |
| Z-Glu-OBzl |
| N-Cbz-D-glutamic |
| Z-D-GLUTAMIC ACID-OBZL |
| N-Carbobenzoxy-L-glutamic Acid 1-Benzyl Ester |
| (S)-5-(benzyloxy)-4-(benzyloxycarbonylamino)-5-oxopentanoic acid |
| Z-D-Glu-OBzl |
| Cbz-D-glutamic acid 1-benzyl ester |
| Cbz-L-Glutamicacid1-benzylester |
| Cbz-D-Glu(OH)-O-Bzl |
| N-Cbz-L-glutamic Acid 1-Benzyl Ester |
| (S)-5-(Benzyloxy)-4-(((benzyloxy)carbonyl)amino)-5-oxopentanoic acid |
| 1-Benzyl N-Cbz-L-glutamate |
| MFCD00069647 |
| Cbz-L-Glutamic acid 1-benzyl ester |
| N-Cbz-D-glutamic aci |
| N-Cbz-D-glutamicacidalpha-benzylester |
| (4S)-5-(Benzyloxy)-4-{[(benzyloxy)carbonyl]amino}-5-oxopentanoic acid |
| (2S)-5-(Benzyloxy)-2-{[(benzyloxy)carbonyl]amino}-5-oxopentanoic acid |
| L-Glutamic acid, N-[(phenylmethoxy)carbonyl]-, 1-(phenylmethyl) ester |
| (2S)-2-benzyloxycarbonylaminopentanedioic acid 1-benzyl ester |
| Z-L-GLUTAMIC ACID-A-BENZYLESTER |
| N-Cbz-Glu-OBn |
| L-Glutamic acid, N-[(phenylmethoxy)carbonyl]-, 5-(phenylmethyl) ester |
| 1-Benzyl N-Carbobenzoxy-L-glutamate |
| Cbz-Glu-OBzl |
| Z-D-Glu-OBn |
| Z-D-GLUTAMIC ACID 1-BENZYL ESTER |