[(3R)-Tetrahydro-2,6-dioxo-2H-pyran-3-yl]-carbamic Acid Phenylmethyl
![[(3R)-Tetrahydro-2,6-dioxo-2H-pyran-3-yl]-carbamic Acid Phenylmethyl Structure](https://image.chemsrc.com/caspic/237/71869-80-2.png)
[(3R)-Tetrahydro-2,6-dioxo-2H-pyran-3-yl]-carbamic Acid Phenylmethyl structure
|
Common Name | [(3R)-Tetrahydro-2,6-dioxo-2H-pyran-3-yl]-carbamic Acid Phenylmethyl | ||
|---|---|---|---|---|
| CAS Number | 71869-80-2 | Molecular Weight | 263.24600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-(benzyloxycarbonyl)-D-glutamic acid anhydride, also known as [(3R)-tetrahydro-2,6-dioxo-2H-pyran-3-yl]-carbamic acid phenylmethyl, with CAS number 71869-80-2, has a molecular formula of C13H13NO5 and a molecular weight of 263.24600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(benzyloxycarbonyl)-D-glutamic acid anhydride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H13NO5 |
|---|---|
| Molecular Weight | 263.24600 |
| Exact Mass | 263.07900 |
| PSA | 81.70000 |
| LogP | 1.53590 |
| InChIKey | YIXAMRRMFCPXNC-SNVBAGLBSA-N |
| SMILES | O=C1CCC(NC(=O)OCc2ccccc2)C(=O)O1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:65706-99-2![Pentanoic acid,5-amino-5-oxo-4-[[(phenylmethoxy)carbonyl]amino]-, (4R) structure](https://image.chemsrc.com/caspic/454/19522-39-5.png)
CAS#:19522-39-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| [(3R)-Tetrahydro-2,6-dioxo-2H-pyran-3-yl]-carbamic Acid Phenylmethyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of N-(benzyloxycarbonyl)-D-glutamic acid anhydride? |
| A: LogP of N-(benzyloxycarbonyl)-D-glutamic acid anhydride is 1.53590. |
| Q: What English synonyms does N-(benzyloxycarbonyl)-D-glutamic acid anhydride have? |
| A: English synonyms of N-(benzyloxycarbonyl)-D-glutamic acid anhydride: [(3R)-Tetrahydro-2,6-dioxo-2H-pyran-3-yl]-carbamic Acid Phenylmethyl. |
| Q: What is the English name of N-(benzyloxycarbonyl)-D-glutamic acid anhydride? |
| A: The English name of N-(benzyloxycarbonyl)-D-glutamic acid anhydride is N-(benzyloxycarbonyl)-D-glutamic acid anhydride. |
| Q: What is the molecular weight of N-(benzyloxycarbonyl)-D-glutamic acid anhydride? |
| A: Molecular weight of N-(benzyloxycarbonyl)-D-glutamic acid anhydride is 263.24600. |
| Q: What is the InChIKey of N-(benzyloxycarbonyl)-D-glutamic acid anhydride? |
| A: InChIKey of N-(benzyloxycarbonyl)-D-glutamic acid anhydride is YIXAMRRMFCPXNC-SNVBAGLBSA-N. |
| Q: What is the Chinese name of 71869-80-2? |
| A: Chinese name of 71869-80-2 is 71869-80-2. |
| Q: What are the downstream products of N-(benzyloxycarbonyl)-D-glutamic acid anhydride? |
| A: Related downstream products(CAS) of N-(benzyloxycarbonyl)-D-glutamic acid anhydride: 65706-99-2;19522-39-5. |
| Q: What is the polar surface area (PSA) of N-(benzyloxycarbonyl)-D-glutamic acid anhydride? |
| A: Polar surface area (PSA) of N-(benzyloxycarbonyl)-D-glutamic acid anhydride is 81.70000. |
| Q: What is the molecular formula of N-(benzyloxycarbonyl)-D-glutamic acid anhydride? |
| A: Molecular formula of N-(benzyloxycarbonyl)-D-glutamic acid anhydride is C13H13NO5. |
| Q: What is the CAS number of N-(benzyloxycarbonyl)-D-glutamic acid anhydride? |
| A: CAS number of N-(benzyloxycarbonyl)-D-glutamic acid anhydride is 71869-80-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |