1-Benzyl-N-(tert-butoxycarbonyl)-D-histidine structure
|
Common Name | 1-Benzyl-N-(tert-butoxycarbonyl)-D-histidine | ||
|---|---|---|---|---|
| CAS Number | 65717-64-8 | Molecular Weight | 345.393 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 578.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H23N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.9±30.1 °C | |
| Name | (R)-3-(1-Benzyl-1H-imidazol-4-yl)-2-((tert-butoxycarbonyl)amino)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 578.8±50.0 °C at 760 mmHg |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.393 |
| Flash Point | 303.9±30.1 °C |
| Exact Mass | 345.168854 |
| PSA | 93.45000 |
| LogP | 3.13 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | OUHPNBGKEMHUCQ-OAHLLOKOSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cn(Cc2ccccc2)cn1)C(=O)O |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-Benzyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-histidine |
| 1-Benzyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-histidine |
| N-Benzyl-N-(tert-butoxycarbonyl)-D-histidine |
| D-Histidine, N-[(1,1-dimethylethoxy)carbonyl]-1-(phenylmethyl)- |
| 1-Benzyl-N-(tert-butoxycarbonyl)-D-histidine |
| D-Histidine, N-[(1,1-dimethylethoxy)carbonyl]-N-(phenylmethyl)- |
| (2R)-3-(1-benzylimidazol-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |