(4-formylphenyl) 4-cyanobenzoate structure
|
Common Name | (4-formylphenyl) 4-cyanobenzoate | ||
|---|---|---|---|---|
| CAS Number | 65731-06-8 | Molecular Weight | 251.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-formylphenyl) 4-cyanobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H9NO3 |
|---|---|
| Molecular Weight | 251.23700 |
| Exact Mass | 251.05800 |
| PSA | 67.16000 |
| LogP | 2.58998 |
| InChIKey | ATIIJHCNBHHCKJ-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(C(=O)Oc2ccc(C=O)cc2)cc1 |
|
~65%
(4-formylphenyl... CAS#:65731-06-8 |
| Literature: Shvartsman, Felix P.; Krongauz, Valeri A. Journal of Physical Chemistry, 1984 , vol. 88, # 25 p. 6448 - 6453 |
|
~%
(4-formylphenyl... CAS#:65731-06-8 |
| Literature: Matsuzaki, Hiroyuki; Matsunaga, Yoshio Bulletin of the Chemical Society of Japan, 1990 , vol. 63, # 8 p. 2300 - 2305 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-(4'-cyanobenzoyloxy)benzaldehyde |
| Benzoic acid,4-cyano-,4-formylphenyl ester |