4-benzoyl-1-(4-nitrophenyl)-5-phenylpyrazole-3-carbonyl chloride structure
|
Common Name | 4-benzoyl-1-(4-nitrophenyl)-5-phenylpyrazole-3-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 658081-82-4 | Molecular Weight | 431.82800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H14ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-benzoyl-1-(4-nitrophenyl)-5-phenylpyrazole-3-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H14ClN3O4 |
|---|---|
| Molecular Weight | 431.82800 |
| Exact Mass | 431.06700 |
| PSA | 97.78000 |
| LogP | 5.58070 |
| InChIKey | KDPWHUKAUJBFIO-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1nn(-c2ccc([N+](=O)[O-])cc2)c(-c2ccccc2)c1C(=O)c1ccccc1 |
|
~63%
4-benzoyl-1-(4-... CAS#:658081-82-4 |
| Literature: Sener; Kasimogullari; Genc Chemistry of Heterocyclic Compounds, 2004 , vol. 40, # 8 p. 1039 - 1046 |
|
~%
4-benzoyl-1-(4-... CAS#:658081-82-4 |
| Literature: Sener; Kasimogullari; Genc Chemistry of Heterocyclic Compounds, 2004 , vol. 40, # 8 p. 1039 - 1046 |
|
~%
4-benzoyl-1-(4-... CAS#:658081-82-4 |
| Literature: Sener; Kasimogullari; Genc Chemistry of Heterocyclic Compounds, 2004 , vol. 40, # 8 p. 1039 - 1046 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-benzoyl-1-(4-nitrophenyl)-5-phenyl-1H-pyrazole-3-carbonyl chloride |
| 4-benzoyl-1-[4-nitrophenyl]-5-phenyl-1H-pyrazole-3-carboxylic acid chloride |
| 1H-Pyrazole-3-carbonyl chloride,4-benzoyl-1-(4-nitrophenyl)-5-phenyl |