1-(4-chloro-2-nitro-phenyl)pyrrole-2,5-dione structure
|
Common Name | 1-(4-chloro-2-nitro-phenyl)pyrrole-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 65833-07-0 | Molecular Weight | 252.61100 | |
| Density | 1.639g/cm3 | Boiling Point | 420.5ºC at 760 mmHg | |
| Molecular Formula | C10H5ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.1ºC | |
| Name | 1-(4-chloro-2-nitrophenyl)-1H-pyrrole-2,5-dione |
|---|
| Density | 1.639g/cm3 |
|---|---|
| Boiling Point | 420.5ºC at 760 mmHg |
| Molecular Formula | C10H5ClN2O4 |
| Molecular Weight | 252.61100 |
| Flash Point | 208.1ºC |
| Exact Mass | 251.99400 |
| PSA | 83.20000 |
| LogP | 2.26580 |
| Index of Refraction | 1.673 |
| InChIKey | SPZIAMZQVVMQHQ-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=O)N1c1ccc(Cl)cc1[N+](=O)[O-] |
|
~72%
1-(4-chloro-2-n... CAS#:65833-07-0 |
| Literature: Hiran; Boriwal, Rajesh; Paliwal; Singh, Divya; Lal, Champa; Bapna, Shivira Journal of the Indian Chemical Society, 2011 , vol. 88, # 3 p. 373 - 380 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |