Morniflumate structure
|
Common Name | Morniflumate | ||
|---|---|---|---|---|
| CAS Number | 65847-85-0 | Molecular Weight | 395.376 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 478.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H20F3N3O3 | Melting Point | 75-77ºC | |
| MSDS | N/A | Flash Point | 243.0±28.7 °C | |
Use of MorniflumateMorniflumate (UP 164) is an orally active nonsteroidal anti-inflammatory agent. Morniflumate can be used in the study of inflammatory diseases such as osteoarthritis, painful musculoskeletal disorders and soft tissue inflammation. |
| Name | 2-morpholin-4-ylethyl 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | Morniflumate (UP 164) is an orally active nonsteroidal anti-inflammatory agent. Morniflumate can be used in the study of inflammatory diseases such as osteoarthritis, painful musculoskeletal disorders and soft tissue inflammation. |
|---|---|
| Related Catalog |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 478.2±45.0 °C at 760 mmHg |
| Melting Point | 75-77ºC |
| Molecular Formula | C19H20F3N3O3 |
| Molecular Weight | 395.376 |
| Flash Point | 243.0±28.7 °C |
| Exact Mass | 395.145691 |
| PSA | 63.69000 |
| LogP | 4.79 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | LDXSPUSKBDTEKA-UHFFFAOYSA-N |
| SMILES | O=C(OCCN1CCOCC1)c1cccnc1Nc1cccc(C(F)(F)F)c1 |
| HS Code | 2934999090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Morniflumatum |
| 2-(Morpholin-4-yl)ethyl 2-{[3-(trifluoromethyl)phenyl]amino}nicotinate |
| Morniflumato |
| 2-Morpholinoethyl 2-(α,α,α-trifluoro-m-toluidino)nicotinate |
| 2-(4-Morpholinyl)ethyl 2-{[3-(trifluoromethyl)phenyl]amino}nicotinate |
| 2-Morpholinoethyl 2-(a,a,a-Trifluoro-m-toluidino)nicotinate |
| flomax |
| β-morpholinoethyl niflumate |
| MFCD00866144 |
| Morniflumate |
| 3-Pyridinecarboxylic acid, 2-[[3-(trifluoromethyl)phenyl]amino]-, 2-(4-morpholinyl)ethyl ester |
| niflumic acid β-morpholinoethyl ester |
| UNII:R133MWH7X1 |