1-hydroxyselanyl-4-methyl-2-nitrobenzene structure
|
Common Name | 1-hydroxyselanyl-4-methyl-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 65848-43-3 | Molecular Weight | 232.09500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7NO3Se | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-hydroxyselanyl-4-methyl-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H7NO3Se |
|---|---|
| Molecular Weight | 232.09500 |
| Exact Mass | 232.95900 |
| PSA | 66.05000 |
| LogP | 1.04340 |
| InChIKey | JGVLOSHDUXJGDW-UHFFFAOYSA-N |
| SMILES | Cc1ccc([Se]O)c([N+](=O)[O-])c1 |
|
~%
1-hydroxyselany... CAS#:65848-43-3 |
| Literature: Kang, Sang-Ihn; Kice, John L. Journal of Organic Chemistry, 1986 , vol. 51, # 3 p. 287 - 290 |
|
~%
1-hydroxyselany... CAS#:65848-43-3 |
| Literature: Kang, Sang-Ihn; Kice, John L. Journal of Organic Chemistry, 1986 , vol. 51, # 3 p. 287 - 290 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-nitro-toluene-4-selenenic acid |
| 3-Nitro-toluol-4-selenensaeure |
| Benzeneselenenic acid,4-methyl-2-nitro |