1-Chloro-4-methyl-2-nitrobenzene structure
|
Common Name | 1-Chloro-4-methyl-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 89-60-1 | Molecular Weight | 171.581 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 264.8±20.0 °C at 760 mmHg | |
| Molecular Formula | C7H6ClNO2 | Melting Point | 7 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 113.9±21.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Chloro-3-nitrotoluene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 264.8±20.0 °C at 760 mmHg |
| Melting Point | 7 °C(lit.) |
| Molecular Formula | C7H6ClNO2 |
| Molecular Weight | 171.581 |
| Flash Point | 113.9±21.8 °C |
| Exact Mass | 171.008713 |
| PSA | 45.82000 |
| LogP | 2.80 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | NWESJZZPAJGHRZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Cl)c([N+](=O)[O-])c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S36/37/39-S26-S61 |
| RIDADR | UN 2433 6.1/PG 3 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 29049085 |
| Precursor 7 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
FT-IR, FT-Raman, ab initio, HF and DFT studies, NBO, HOMO-LUMO and electronic structure calculations on 4-chloro-3-nitrotoluene.
Spectrochim. Acta. A. Mol. Biomol. Spectrosc. 89 , 137-48, (2012) In this work, the vibrational spectral analysis was carried out by using Raman and infrared spectroscopy in the range 100-4000 cm(-1) and 50-4000 cm(-1), respectively, for 4-chloro-3-nitrotoluene (C7H... |
|
|
Synthesis of imidazo[1,5,4-de]quinoxalin-9-ones, benzimidazole analogues of pyrroloiminoquinone marine natural products.
Bioorg. Med. Chem. 13(2) , 387-95, (2005) The imidazoquinoxalinones 1 and 2 are benzimidazole analogues of indole-based marine natural products called makaluvamins. The stabilized cation 1 and the zwitterion 2 were prepared in approximately 9... |
| toluene,4-chloro-3-nitro |
| 3-nitro-4-chlorotoluene |
| 3-nitro-4-chlorotoluol |
| M-NITRO-P-CHLOROTOLUENE |
| 4-methyl-2-nitrochlorobenzene |
| 2-Chloro-5-methylnitrobenzene |
| 3-NITRO-4-CHLORO TOLUENE |
| EINECS 201-922-8 |
| 1-Chloro-4-methyl-2-nitrobenzene |
| MFCD00007085 |
| 4,3-Chloronitrotoluene |
| 4-chloro-3-nitro-toluene |
| 4-Chloro-3-nitrotoluene |