Methyl (2E)-4-(triphenylphosphoranylidene)-2-butenoate structure
|
Common Name | Methyl (2E)-4-(triphenylphosphoranylidene)-2-butenoate | ||
|---|---|---|---|---|
| CAS Number | 65866-00-4 | Molecular Weight | 360.38500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H21O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl (2E)-4-(triphenylphosphoranylidene)-2-butenoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H21O2P |
|---|---|
| Molecular Weight | 360.38500 |
| Exact Mass | 360.12800 |
| PSA | 36.11000 |
| LogP | 3.51190 |
| InChIKey | CEXRFAVACANSIF-WOJGMQOQSA-N |
| SMILES | COC(=O)C=CC=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
|
~%
Methyl (2E)-4-(... CAS#:65866-00-4 |
| Literature: Kim, Seong-Kie; Hatori, Makoto; Ojika, Makoto; Sakagami, Youji; Marumo, Shingo Bioorganic and Medicinal Chemistry, 1998 , vol. 6, # 11 p. 1975 - 1982 |
|
~%
Methyl (2E)-4-(... CAS#:65866-00-4 |
| Literature: Kim, Seong-Kie; Hatori, Makoto; Ojika, Makoto; Sakagami, Youji; Marumo, Shingo Bioorganic and Medicinal Chemistry, 1998 , vol. 6, # 11 p. 1975 - 1982 |
|
~%
Methyl (2E)-4-(... CAS#:65866-00-4 |
| Literature: Kim, Seong-Kie; Hatori, Makoto; Ojika, Makoto; Sakagami, Youji; Marumo, Shingo Bioorganic and Medicinal Chemistry, 1998 , vol. 6, # 11 p. 1975 - 1982 |
|
~%
Methyl (2E)-4-(... CAS#:65866-00-4 |
| Literature: Dener, Jeffrey M.; Rice, Kenneth D.; Newcomb, William S.; Wang, Vivian R.; Young, Wendy B.; Gangloff, Anthony R.; Kuo, Elaine Y.-L.; Cregar, Lynne; Putnam, Daun; Wong, Martin Bioorganic and Medicinal Chemistry Letters, 2001 , vol. 11, # 13 p. 1629 - 1633 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Buten-1-ol,3-methoxy-,(2E) |
| 2-Buten-1-ol,3-methoxy |
| (E)-3-methoxy-2-buten-1-ol |
| (E)-3-methoxy-but-2-en-1-ol |
| trans-3-methoxybut-2-en-1-ol |
| (E)-3-methoxycarbonyl-2-propenylidenetriphenylphosphorane |
| methyl (E)-3-(methoxycarbonyl)-2-propenylidene-triphenylphosphorane |
| methyl 4-(triphenylphosphoranylidene)-crotonate |
| 3-methoxycarbonyl-2-propenylidene triphenyl phosphonate |
| [3-carbomethoxy-2-propen-1-ylidene]-triphenyl-phosphorane |
| [3-carbomethoxyprop-2-en-1-ylidene]-triphenylphosphorane |
| methyl (2E)-4-(triphenylphosphoranylidene)but-2-enoate |