Danshenxinkun B structure
|
Common Name | Danshenxinkun B | ||
|---|---|---|---|---|
| CAS Number | 65907-76-8 | Molecular Weight | 280.31800 | |
| Density | 1.285±0.06 g/cm3 | Boiling Point | 465.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Danshenxinkun BDanshenxinkun B is an antioxidative component of tanshen (Salvia miltiorhiza Bung) [1]. |
| Name | 1-hydroxy-8-methyl-2-propan-2-ylphenanthrene-3,4-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Danshenxinkun B is an antioxidative component of tanshen (Salvia miltiorhiza Bung) [1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.285±0.06 g/cm3 |
|---|---|
| Boiling Point | 465.2±45.0 °C at 760 mmHg |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.31800 |
| Exact Mass | 280.11000 |
| PSA | 54.37000 |
| LogP | 3.83870 |
| InChIKey | PVIJIAVGFMTLEI-UHFFFAOYSA-N |
| SMILES | Cc1cccc2c3c(ccc12)C(O)=C(C(C)C)C(=O)C3=O |
| danshexinkun |
| 2-Isopropyl-3-hydroxy-8-methyl-phenanthrachinon-(1.4) |
| danshenxinkun B |
| 3-Hydroxy-2-isopropyl-8-methyl-1,4-phenanthrenedione |
| danshexinkun B |