1-Boc-4-(cyanoacetyl)piperidine structure
|
Common Name | 1-Boc-4-(cyanoacetyl)piperidine | ||
|---|---|---|---|---|
| CAS Number | 660406-84-8 | Molecular Weight | 252.309 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 365.0±32.0 °C at 760 mmHg | |
| Molecular Formula | C13H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.5±25.1 °C | |
| Name | tert-Butyl 4-(2-cyanoacetyl)piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 365.0±32.0 °C at 760 mmHg |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.309 |
| Flash Point | 174.5±25.1 °C |
| Exact Mass | 252.147400 |
| PSA | 70.40000 |
| LogP | 0.65 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.489 |
| InChIKey | VSLLBQBSHAGKLC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)CC#N)CC1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~%
1-Boc-4-(cyanoa... CAS#:660406-84-8 |
| Literature: WO2004/14910 A1, ; Page 32-33 ; WO 2004/014910 A1 |
|
~%
1-Boc-4-(cyanoa... CAS#:660406-84-8 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 21, # 1 p. 471 - 474 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-2-propanyl 4-(cyanoacetyl)-1-piperidinecarboxylate |
| tert-butyl 4-(2-cyanoacetyl)piperidine-1-carboxylate |
| 1-Piperidinecarboxylic acid, 4-(2-cyanoacetyl)-, 1,1-dimethylethyl ester |
| MFCD08059465 |
| 4-(2-Cyanoacetyl)piperidine-1-carboxylic acid tert-butyl ester |
| 1-Boc-4-(cyanoacetyl)piperidine |