2 5-BIS(CHLOROMETHYL)-1 4-BIS(BUTOXY)BE& structure
|
Common Name | 2 5-BIS(CHLOROMETHYL)-1 4-BIS(BUTOXY)BE& | ||
|---|---|---|---|---|
| CAS Number | 6606-68-4 | Molecular Weight | 455.52800 | |
| Density | 1.39g/cm3 | Boiling Point | 755.7ºC at 760 mmHg | |
| Molecular Formula | C26H21N3O3S | Melting Point | 85-87ºC(lit.) | |
| MSDS | N/A | Flash Point | 410.9ºC | |
| Name | 1-(4-ethoxyphenyl)-3-(4-phenylquinazolin-2-yl)sulfanylpyrrolidine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 755.7ºC at 760 mmHg |
| Melting Point | 85-87ºC(lit.) |
| Molecular Formula | C26H21N3O3S |
| Molecular Weight | 455.52800 |
| Flash Point | 410.9ºC |
| Exact Mass | 455.13000 |
| PSA | 97.69000 |
| LogP | 5.18470 |
| Index of Refraction | 1.717 |
| InChIKey | PYHCKEFKJQBTBH-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(N2C(=O)CC(Sc3nc(-c4ccccc4)c4ccccc4n3)C2=O)cc1 |
| Risk Phrases | 34 |
|---|---|
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| HS Code | 2909309090 |
|
~88%
2 5-BIS(CHLOROM... CAS#:6606-68-4 |
| Literature: Data, P.; Lapkowski, M.; Motyka, R.; Suwinski, J. Electrochimica Acta, 2012 , vol. 83, p. 271 - 282,12 |
|
~%
2 5-BIS(CHLOROM... CAS#:6606-68-4 |
| Literature: Data, P.; Lapkowski, M.; Motyka, R.; Suwinski, J. Electrochimica Acta, 2012 , vol. 83, p. 271 - 282,12 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,4-dibutoxy-2,5-bis(chloromethyl)benzene |
| 2,5-bis(chloromethyl)-1,4-dibutoxybenzene |
| 1-(4-ethoxyphenyl)-3-[(4-phenylquinazolin-2-yl)sulfanyl]pyrrolidine-2,5-dione |
| 1,4-Dibutoxy-2,5-bis-chlormethyl-benzol |