2,2-bis(4-methoxyphenyl)indene-1,3-dione structure
|
Common Name | 2,2-bis(4-methoxyphenyl)indene-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 66064-61-7 | Molecular Weight | 358.38700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2-bis(4-methoxyphenyl)indene-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H18O4 |
|---|---|
| Molecular Weight | 358.38700 |
| Exact Mass | 358.12100 |
| PSA | 52.60000 |
| LogP | 4.06910 |
| InChIKey | GQLYGAHCVICOGX-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)C(=O)c3ccccc3C2=O)cc1 |
|
~90%
2,2-bis(4-metho... CAS#:66064-61-7 |
| Literature: Kundu, Sandip Kumar; Patra, Amarendra; Pramanik, Animesh Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2004 , vol. 43, # 3 p. 604 - 611 |
| 2,2-di-para-methoxyphenyl-1,3-indanedione |
| 1H-Indene-1,3(2H)-dione,2,2-bis(4-methoxyphenyl) |
| 2,2-Bis-(4-methoxyphenyl)-1,3-indandion |