2-amino-4-[3,5-bis(trifluoromethyl)phenyl]amino-1,3,5-triazine structure
|
Common Name | 2-amino-4-[3,5-bis(trifluoromethyl)phenyl]amino-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 66088-50-4 | Molecular Weight | 323.19700 | |
| Density | 1.58g/cm3 | Boiling Point | 374.2ºC at 760 mmHg | |
| Molecular Formula | C11H7F6N5 | Melting Point | 259-261°C | |
| MSDS | N/A | Flash Point | 180.1ºC | |
| Name | 2-Amino-4-[3,5-bis(trifluoromethyl)phenyl]-amino-1,3,5-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 374.2ºC at 760 mmHg |
| Melting Point | 259-261°C |
| Molecular Formula | C11H7F6N5 |
| Molecular Weight | 323.19700 |
| Flash Point | 180.1ºC |
| Exact Mass | 323.06100 |
| PSA | 76.72000 |
| LogP | 3.88920 |
| Index of Refraction | 1.539 |
| InChIKey | XHHILSKOTPAJFK-UHFFFAOYSA-N |
| SMILES | Nc1ncnc(Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933699090 |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 2-N-[3,5-bis(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
| MFCD00052346 |