(+)-3-METHYLHEXANEDIOICACID
Modify Date: 2025-08-27 15:36:16
(+)-3-METHYLHEXANEDIOICACID structure
|
Common Name | (+)-3-METHYLHEXANEDIOICACID | ||
|---|---|---|---|---|
| CAS Number | 6614-52-4 | Molecular Weight | 256.25200 | |
| Density | 1.45g/cm3 | Boiling Point | 475.5ºC at 760 mmHg | |
| Molecular Formula | C12H16O6 | Melting Point | 180ºC (dec.)(lit.) | |
| MSDS | N/A | Flash Point | 186.8ºC | |
| Name | 2-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-3,4-dihydroxy-2H-furan-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 475.5ºC at 760 mmHg |
| Melting Point | 180ºC (dec.)(lit.) |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25200 |
| Flash Point | 186.8ºC |
| Exact Mass | 256.09500 |
| PSA | 85.22000 |
| LogP | 1.31520 |
| Index of Refraction | 1.589 |
| InChIKey | SKQBFUVTZXIHLB-BYDSUWOYSA-N |
| SMILES | O=C1OC(C2COC3(CCCCC3)O2)C(O)=C1O |
| Safety Phrases | 22-24/25 |
|---|---|
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,6-O-cyclohexylidene ascorbic acid |
| 5,6-O-cyclohexylidene-L-ascorbic acid |