2-oxo-1-[4-(trifluoromethyl)benzyl]-1,2-dihydro-3-pyridinecarboxylic acid structure
|
Common Name | 2-oxo-1-[4-(trifluoromethyl)benzyl]-1,2-dihydro-3-pyridinecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 66158-46-1 | Molecular Weight | 297.22900 | |
| Density | 1.466g/cm3 | Boiling Point | 465.4ºC at 760 mmHg | |
| Molecular Formula | C14H10F3NO3 | Melting Point | 192-193ºC | |
| MSDS | N/A | Flash Point | 235.3ºC | |
| Name | 2-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]pyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.466g/cm3 |
|---|---|
| Boiling Point | 465.4ºC at 760 mmHg |
| Melting Point | 192-193ºC |
| Molecular Formula | C14H10F3NO3 |
| Molecular Weight | 297.22900 |
| Flash Point | 235.3ºC |
| Exact Mass | 297.06100 |
| PSA | 59.30000 |
| LogP | 2.61360 |
| Index of Refraction | 1.567 |
| InChIKey | QEVYEOVHIKEWCV-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccn(Cc2ccc(C(F)(F)F)cc2)c1=O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~%
2-oxo-1-[4-(tri... CAS#:66158-46-1 |
| Literature: WO2008/5457 A2, ; Page/Page column 98 ; WO 2008/005457 A2 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-oxo-1-{[4-(trifluoromethyl)phenyl]methyl}pyridine-3-carboxylic acid |
| 2-oxo-1-(4-trifluoromethyl-benzyl)-1,2-dihydro-pyridine-3-carboxylic acid |
| MFCD00243696 |
| 2-Oxo-1-[4-(Trifluoromethyl)Benzyl]-1,2-Dihydro-3-Pyridinecarboxylic Acid |
| 1-(4-Trifluormethyl-benzyl)-1,2-dihydro-2-oxo-nicotinsaeure |
| 1-[4-(trifluoromethyl)benzyl]pyridin-2-one-3-carboxylic acid |
| F2153-0006 |