7-chloro-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoyl fluoride
Modify Date: 2025-08-27 10:48:02
7-chloro-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoyl fluoride structure
|
Common Name | 7-chloro-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 662-63-5 | Molecular Weight | 382.50700 | |
| Density | 1.709g/cm3 | Boiling Point | 46ºC 55mm | |
| Molecular Formula | C7ClF13O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 46.2ºC | |
| Name | 7-chloro-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoyl fluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.709g/cm3 |
|---|---|
| Boiling Point | 46ºC 55mm |
| Molecular Formula | C7ClF13O |
| Molecular Weight | 382.50700 |
| Flash Point | 46.2ºC |
| Exact Mass | 381.94300 |
| PSA | 17.07000 |
| LogP | 4.49060 |
| Index of Refraction | 1.295 |
| InChIKey | JSDBFOSAQSKPPJ-UHFFFAOYSA-N |
| SMILES | O=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| Hazard Codes | C,Xi |
|---|---|
| Risk Phrases | 34 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 3265 |
| HS Code | 2915900090 |
|
~%
7-chloro-2,2,3,... CAS#:662-63-5 |
| Literature: Journal of Organic Chemistry, , vol. 26, p. 5091 - 5099 |
|
~%
7-chloro-2,2,3,... CAS#:662-63-5 |
| Literature: Journal of Organic Chemistry, , vol. 26, p. 5091 - 5099 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:1550-24-9| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 7-Chloroperfluoroheptanoyl fluoride |
| PC9328 |
| 7-Chlor-perfluor-heptanoylfluorid |