7,8-dimethoxy-2-quinolin-2-yl-chromen-4-one structure
|
Common Name | 7,8-dimethoxy-2-quinolin-2-yl-chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 6622-20-4 | Molecular Weight | 333.33700 | |
| Density | 1.309g/cm3 | Boiling Point | 553.8ºC at 760 mmHg | |
| Molecular Formula | C20H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.8ºC | |
| Name | 7,8-dimethoxy-2-quinolin-2-ylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.309g/cm3 |
|---|---|
| Boiling Point | 553.8ºC at 760 mmHg |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.33700 |
| Flash Point | 288.8ºC |
| Exact Mass | 333.10000 |
| PSA | 61.56000 |
| LogP | 4.02540 |
| Index of Refraction | 1.655 |
| InChIKey | OIAHIWVJDSFLPY-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(=O)cc(-c3ccc4ccccc4n3)oc2c1OC |
|
~%
7,8-dimethoxy-2... CAS#:6622-20-4 |
| Literature: Donnelly,D. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 872 - 875 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 7,8-dimethoxy-2-quinolin-2-yl-chromen-4-one |
| 7,8-dimethoxy-2-(quinolin-2-yl)-4h-chromen-4-one |
| 2-<Chinolyl-(2)>-7,8-dimethoxy-chromon |