6-methoxy-2-quinolin-2-yl-chromen-4-one structure
|
Common Name | 6-methoxy-2-quinolin-2-yl-chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 7209-71-4 | Molecular Weight | 303.31100 | |
| Density | 1.315g/cm3 | Boiling Point | 520.9ºC at 760 mmHg | |
| Molecular Formula | C19H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.8ºC | |
| Name | 6-methoxy-2-quinolin-2-ylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.315g/cm3 |
|---|---|
| Boiling Point | 520.9ºC at 760 mmHg |
| Molecular Formula | C19H13NO3 |
| Molecular Weight | 303.31100 |
| Flash Point | 268.8ºC |
| Exact Mass | 303.09000 |
| PSA | 52.33000 |
| LogP | 4.01680 |
| Index of Refraction | 1.676 |
| InChIKey | DAVUOFSDMFFFAI-UHFFFAOYSA-N |
| SMILES | COc1ccc2oc(-c3ccc4ccccc4n3)cc(=O)c2c1 |
|
~%
6-methoxy-2-qui... CAS#:7209-71-4 |
| Literature: Donnelly,D. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 872 - 875 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 6-methoxy-2-quinolin-2-yl-chromen-4-one |