7-chloro-3-methyl-6-nitro-quinazolin-4-one structure
|
Common Name | 7-chloro-3-methyl-6-nitro-quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 66234-45-5 | Molecular Weight | 239.61500 | |
| Density | 1.62g/cm3 | Boiling Point | 437ºC at 760 mmHg | |
| Molecular Formula | C9H6ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.1ºC | |
| Name | 7-chloro-3-methyl-6-nitroquinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 437ºC at 760 mmHg |
| Molecular Formula | C9H6ClN3O3 |
| Molecular Weight | 239.61500 |
| Flash Point | 218.1ºC |
| Exact Mass | 239.01000 |
| PSA | 80.71000 |
| LogP | 2.01830 |
| Index of Refraction | 1.7 |
| InChIKey | GNDDBCHMNYZOIC-UHFFFAOYSA-N |
| SMILES | Cn1cnc2cc(Cl)c([N+](=O)[O-])cc2c1=O |
|
~56%
7-chloro-3-meth... CAS#:66234-45-5 |
| Literature: Kumar, Shiv; Kansal, V. K.; Bhaduri, A. P. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1981 , vol. 20, # 12 p. 1068 - 1071 |
| 3-Methyl-6-nitro-7-chlor-chinazolin-4-on |
| 7-chloro-3-methyl-6-nitro-3H-quinazolin-4-one |