3-methyl-6-nitro-7-(3-phenylpropylamino)quinazolin-4-one structure
|
Common Name | 3-methyl-6-nitro-7-(3-phenylpropylamino)quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 81946-06-7 | Molecular Weight | 338.36100 | |
| Density | 1.3g/cm3 | Boiling Point | 583ºC at 760 mmHg | |
| Molecular Formula | C18H18N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.4ºC | |
| Name | 3-methyl-6-nitro-7-(3-phenylpropylamino)quinazolin-4-one |
|---|
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 583ºC at 760 mmHg |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.36100 |
| Flash Point | 306.4ºC |
| Exact Mass | 338.13800 |
| PSA | 92.74000 |
| LogP | 3.48260 |
| Index of Refraction | 1.648 |
| InChIKey | PTZQCNRMATXIOY-UHFFFAOYSA-N |
| SMILES | Cn1cnc2cc(NCCCc3ccccc3)c([N+](=O)[O-])cc2c1=O |
|
~66%
3-methyl-6-nitr... CAS#:81946-06-7 |
| Literature: Kumar, Shiv; Kansal, V. K.; Bhaduri, A. P. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1981 , vol. 20, # 12 p. 1068 - 1071 |
|
~%
3-methyl-6-nitr... CAS#:81946-06-7 |
| Literature: Kumar, Shiv; Kansal, V. K.; Bhaduri, A. P. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1981 , vol. 20, # 12 p. 1068 - 1071 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |