Cyclopentanecarboxylicacid, 1,2,2-trimethyl-3-[[(3-methylphenyl)amino]carbonyl]-, (1R,3S)- structure
|
Common Name | Cyclopentanecarboxylicacid, 1,2,2-trimethyl-3-[[(3-methylphenyl)amino]carbonyl]-, (1R,3S)- | ||
|---|---|---|---|---|
| CAS Number | 6626-17-1 | Molecular Weight | 289.36900 | |
| Density | 1.145g/cm3 | Boiling Point | 479.6ºC at 760mmHg | |
| Molecular Formula | C17H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.9ºC | |
| Name | (1R,3S)-1,2,2-trimethyl-3-[(3-methylphenyl)carbamoyl]cyclopentane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.145g/cm3 |
|---|---|
| Boiling Point | 479.6ºC at 760mmHg |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.36900 |
| Flash Point | 243.9ºC |
| Exact Mass | 289.16800 |
| PSA | 66.40000 |
| LogP | 3.53360 |
| Index of Refraction | 1.559 |
| InChIKey | HGOCUIVFSFVMKK-UHFFFAOYSA-N |
| SMILES | Cc1cccc(NC(=O)C2CCC(C)(C(=O)O)C2(C)C)c1 |
|
~%
Cyclopentanecar... CAS#:6626-17-1 |
| Literature: Wootton Journal of the Chemical Society, 1910 , vol. 97, p. 415 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,2,2-trimethyl-3-m-tolylcarbamoyl-cyclopentanecarboxylic acid |
| 1,2,2-Trimethyl-3-m-tolylcarbamoyl-cyclopentancarbonsaeure |
| 1,2,2-Trimethyl-3-methylcarbamoyl-cyclopentancarbonsaeure |
| 1,2,2-trimethyl-3-methylcarbamoyl-cyclopentanecarboxylic acid |
| (1S,3R)-1,2,2-trimethyl-3-(methylcarbamoyl)cyclopentane-1-carboxylic acid |