Benzenamine,2,4,6-trimethyl-N-[[(2,4,6-trimethylphenyl)thio]methyl]- structure
|
Common Name | Benzenamine,2,4,6-trimethyl-N-[[(2,4,6-trimethylphenyl)thio]methyl]- | ||
|---|---|---|---|---|
| CAS Number | 6629-72-7 | Molecular Weight | 299.47400 | |
| Density | 1.05g/cm3 | Boiling Point | 424ºC at 760mmHg | |
| Molecular Formula | C19H25NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.2ºC | |
| Name | 2,4,6-trimethyl-N-[(2,4,6-trimethylphenyl)sulfanylmethyl]aniline |
|---|
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 424ºC at 760mmHg |
| Molecular Formula | C19H25NS |
| Molecular Weight | 299.47400 |
| Flash Point | 210.2ºC |
| Exact Mass | 299.17100 |
| PSA | 37.33000 |
| LogP | 5.77170 |
| Index of Refraction | 1.588 |
| InChIKey | VLXLGVGNZUAGAV-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(NCSc2c(C)cc(C)cc2C)c(C)c1 |
|
~%
Benzenamine,2,4... CAS#:6629-72-7 |
| Literature: Grillot; Schaffrath Journal of Organic Chemistry, 1959 , vol. 24, p. 1035,1036 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |