Pentanoic acid, 4,4,5,5,5-pentafluoro-3-oxo-, ethyl ester
Modify Date: 2026-07-08 16:06:29
Pentanoic acid, 4,4,5,5,5-pentafluoro-3-oxo-, ethyl ester structure
|
Common Name | Pentanoic acid, 4,4,5,5,5-pentafluoro-3-oxo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 663-35-4 | Molecular Weight | 234.12100 | |
| Density | 1.338 g/mL at 25 °C(lit.) | Boiling Point | 143-145 °C(lit.) | |
| Molecular Formula | C7H7F5O3 | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 118 °F | |
| Symbol |
GHS02 |
Signal Word | Warning | |
| Name | Ethyl pentafluoropropionylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.338 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 143-145 °C(lit.) |
| Molecular Formula | C7H7F5O3 |
| Molecular Weight | 234.12100 |
| Flash Point | 118 °F |
| Exact Mass | 234.03200 |
| PSA | 43.37000 |
| LogP | 1.70630 |
| Index of Refraction | n20/D 1.367(lit.) |
| InChIKey | MWGSZQXKIYWSFS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C(F)(F)C(F)(F)F |
| Symbol |
GHS02 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H226 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | F |
| Risk Phrases | R10;R36/37/38 |
| Safety Phrases | S16 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 3 |
| HS Code | 2918300090 |
|
~43%
Pentanoic acid,... CAS#:663-35-4 |
| Literature: Shionogi and Co., Ltd. Patent: US5082947 A1, 1992 ; |
|
~%
Pentanoic acid,... CAS#:663-35-4 |
| Literature: Tetrahedron, , vol. 63, # 9 p. 2042 - 2046 |
|
~%
Pentanoic acid,... CAS#:663-35-4 |
| Literature: Journal of Fluorine Chemistry, , vol. 42, p. 17 - 30 |
CAS#:1646-18-0
CAS#:72850-56-7| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethyl pentafluoropropionylacetate |
| MFCD00013569 |