1-Butyl-3-methylimidazolium dibutyl phosphate structure
|
Common Name | 1-Butyl-3-methylimidazolium dibutyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 663199-28-8 | Molecular Weight | 348.418 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H33N2O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-Butyl-3-methylimidazolium dibutyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H33N2O4P |
|---|---|
| Molecular Weight | 348.418 |
| Exact Mass | 348.217804 |
| PSA | 77.21000 |
| LogP | 4.27110 |
| Appearance of Characters | Liquid | Brown |
| Index of Refraction | n20/D 1.472 |
| InChIKey | NTXQJRGQUZXUMU-UHFFFAOYSA-M |
| SMILES | CCCCOP(=O)([O-])OCCCC.CCCCn1cc[n+](C)c1 |
| Storage condition | 2-8℃ |
| Water Solubility | Insoluble in water. |
| 1-Butyl-3-methyl-1H-imidazol-3-ium dibutyl phosphate |