Morpholine, 4-[[(2,4,6-trimethylphenyl)thio]methyl]- structure
|
Common Name | Morpholine, 4-[[(2,4,6-trimethylphenyl)thio]methyl]- | ||
|---|---|---|---|---|
| CAS Number | 6632-02-6 | Molecular Weight | 251.38800 | |
| Density | 1.1g/cm3 | Boiling Point | 332.2ºC at 760mmHg | |
| Molecular Formula | C14H21NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.7ºC | |
| Name | 4-[(2,4,6-trimethylphenyl)sulfanylmethyl]morpholine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 332.2ºC at 760mmHg |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.38800 |
| Flash Point | 154.7ºC |
| Exact Mass | 251.13400 |
| PSA | 37.77000 |
| LogP | 2.93150 |
| Index of Refraction | 1.574 |
| InChIKey | GVPGDGJBLCJQAN-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(SCN2CCOCC2)c(C)c1 |
|
~%
Morpholine, 4-[... CAS#:6632-02-6 |
| Literature: Grillot et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 3969 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-(mesitylmercapto-methyl)-morpholine |
| 4-{[(2,4,6-trimethylphenyl)sulfanyl]methyl}morpholine |