[4-(2-iodoethyl)phenyl] 4-nitrobenzoate structure
|
Common Name | [4-(2-iodoethyl)phenyl] 4-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 6632-04-8 | Molecular Weight | 397.16500 | |
| Density | 1.68g/cm3 | Boiling Point | 502ºC at 760 mmHg | |
| Molecular Formula | C15H12INO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.4ºC | |
| Name | [4-(2-iodoethyl)phenyl] 4-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.68g/cm3 |
|---|---|
| Boiling Point | 502ºC at 760 mmHg |
| Molecular Formula | C15H12INO4 |
| Molecular Weight | 397.16500 |
| Flash Point | 257.4ºC |
| Exact Mass | 396.98100 |
| PSA | 72.12000 |
| LogP | 4.31470 |
| Index of Refraction | 1.657 |
| InChIKey | JVGPDRSTYQHRHH-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccc(CCI)cc1)c1ccc([N+](=O)[O-])cc1 |
|
~%
[4-(2-iodoethyl... CAS#:6632-04-8 |
| Literature: Cheng et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 4081,4082 |
|
~%
[4-(2-iodoethyl... CAS#:6632-04-8 |
| Literature: Cheng et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 4081,4082 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-(2-iodoethyl)phenyl 4-nitrobenzoate |
| 4-nitro-benzoic acid-[4-(2-iodo-ethyl)-phenyl ester] |
| 4-Nitro-benzoesaeure-[4-(2-jod-aethyl)-phenylester] |