1-(4-chlorphenyl)-4,4-dimethylpentan-3-on structure
|
Common Name | 1-(4-chlorphenyl)-4,4-dimethylpentan-3-on | ||
|---|---|---|---|---|
| CAS Number | 66346-01-8 | Molecular Weight | 224.727 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 297.4±15.0 °C at 760 mmHg | |
| Molecular Formula | C13H17ClO | Melting Point | 18ºC | |
| MSDS | N/A | Flash Point | 178.9±11.5 °C | |
| Name | 1-(4-Chlorophenyl)-4,4-dimethyl-3-pentanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 297.4±15.0 °C at 760 mmHg |
| Melting Point | 18ºC |
| Molecular Formula | C13H17ClO |
| Molecular Weight | 224.727 |
| Flash Point | 178.9±11.5 °C |
| Exact Mass | 224.096786 |
| PSA | 17.07000 |
| LogP | 3.49 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.509 |
| InChIKey | ILQGIJDYSLHIOX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CCc1ccc(Cl)cc1 |
| Storage condition | 2-8 °C |
| Hazard Codes | F |
|---|---|
| HS Code | 2914700090 |
|
~%
1-(4-chlorpheny... CAS#:66346-01-8 |
| Literature: US4243405 A1, ; |
|
~%
1-(4-chlorpheny... CAS#:66346-01-8 |
| Literature: US4940819 A1, ; |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| t-butyl-4-chlorophenethylketone |
| GR D2VX1&1&1 |
| MFCD00270771 |
| 4-diMethyl-3-pentanone |
| 3-Pentanone, 1-(4-chlorophenyl)-4,4-dimethyl- |
| tebuconazole impurity 1 |
| hwg1608-alkylketon |
| 1-(4-chlorphenyl)-4,4-dimethylpentan-3-on |
| 1-(4-Chlorophenyl)-4,4-dimethyl-3-pentanone |
| 1-(4-Chlorophenyl)-4,4-dimethylpentan-3-one |