N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea
![N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea Structure](https://image.chemsrc.com/caspic/351/66357-07-1.png)
N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea structure
|
Common Name | N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea | ||
|---|---|---|---|---|
| CAS Number | 66357-07-1 | Molecular Weight | 271.37900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)urea, CAS number 66357-07-1, molecular formula C12H21N3O2S, molecular weight 271.37900. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H21N3O2S |
|---|---|
| Molecular Weight | 271.37900 |
| Exact Mass | 271.13500 |
| PSA | 82.81000 |
| LogP | 2.28520 |
| InChIKey | NRBJTCXMARKNCT-UHFFFAOYSA-N |
| SMILES | CNC(=O)NCCSCc1ccc(CN(C)C)o1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:66357-35-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-[2-[[[5-(dimethylamino)methyl-2-furanyl]methyl]thio]ethyl]-N'-methylurea |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea? |
| A: The English name of N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea is N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea. |
| Q: What is the SMILES notation of N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea? |
| A: SMILES notation of N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea is CNC(=O)NCCSCc1ccc(CN(C)C)o1. |
| Q: What is the Chinese name of 66357-07-1? |
| A: Chinese name of 66357-07-1 is 66357-07-1. |
| Q: What is the polar surface area (PSA) of N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea? |
| A: Polar surface area (PSA) of N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea is 82.81000. |
| Q: What is the CAS number of N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea? |
| A: CAS number of N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea is 66357-07-1. |
| Q: What is the molecular weight of N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea? |
| A: Molecular weight of N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea is 271.37900. |
| Q: What is the molecular formula of N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea? |
| A: Molecular formula of N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea is C12H21N3O2S. |
| Q: What is the LogP of N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea? |
| A: LogP of N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea is 2.28520. |
| Q: What is the InChIKey of N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea? |
| A: InChIKey of N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea is NRBJTCXMARKNCT-UHFFFAOYSA-N. |
| Q: What are the downstream products of N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea? |
| A: Related downstream products(CAS) of N-methyl-N'-(2-[(5-dimethylaminomethyl)-furan-2-ylmethylthio]-ethyl)-urea: 66357-35-5. |