N-carbamoyl-2-phenethyl-pentanamide structure
|
Common Name | N-carbamoyl-2-phenethyl-pentanamide | ||
|---|---|---|---|---|
| CAS Number | 6636-15-3 | Molecular Weight | 248.32100 | |
| Density | 1.087g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | <2-p-ethyl-D-phenylalanine>oxytocin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.087g/cm3 |
|---|---|
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.32100 |
| Exact Mass | 248.15200 |
| PSA | 72.19000 |
| LogP | 3.32160 |
| Index of Refraction | 1.531 |
| InChIKey | WUWVBSFPGZBYGA-UHFFFAOYSA-N |
| SMILES | CCCC(CCc1ccccc1)C(=O)NC(N)=O |
|
~%
N-carbamoyl-2-p... CAS#:6636-15-3 |
| Literature: Blicke; Centolella Journal of the American Chemical Society, 1938 , vol. 60, p. 2923 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-(4-Ethyl-phe)-oxytocin |
| (2-phenethyl-valeryl)-urea |
| Oxytocin,2-(4-ethylphenylalanine) |
| 1-[19-amino-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13-butan-2-yl-16-[(4-ethylphenyl)methyl]-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentazacycloicosane-4-carbonyl]-N-[1-[(2-amino-2-oxoethyl)amino]-4-methyl-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
| Oxytocin,(4-ethyl-phe)(2) |
| (2-Phenaethyl-valeryl)-harnstoff |
| Oxytocin,(4-ethylphenylalanine)(2) |