2-amino-4,5,6,7-tetrachloro-isoindole-1,3-dione
Modify Date: 2025-09-21 11:08:16
2-amino-4,5,6,7-tetrachloro-isoindole-1,3-dione structure
|
Common Name | 2-amino-4,5,6,7-tetrachloro-isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 6641-31-2 | Molecular Weight | 299.92600 | |
| Density | 1.898g/cm3 | Boiling Point | 511.8ºC at 760mmHg | |
| Molecular Formula | C8H2Cl4N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.3ºC | |
| Name | 2-amino-4,5,6,7-tetrachloroisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.898g/cm3 |
|---|---|
| Boiling Point | 511.8ºC at 760mmHg |
| Molecular Formula | C8H2Cl4N2O2 |
| Molecular Weight | 299.92600 |
| Flash Point | 263.3ºC |
| Exact Mass | 297.88700 |
| PSA | 63.40000 |
| LogP | 3.40810 |
| InChIKey | BTGWIXSUAQPDHV-UHFFFAOYSA-N |
| SMILES | NN1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
|
~%
2-amino-4,5,6,7... CAS#:6641-31-2 |
| Literature: Drew; Pearman Journal of the Chemical Society, 1937 , p. 26,31 |
|
~%
2-amino-4,5,6,7... CAS#:6641-31-2 |
| Literature: Drew; Pearman Journal of the Chemical Society, 1937 , p. 26,31 |
|
~%
2-amino-4,5,6,7... CAS#:6641-31-2 |
| Literature: Drew; Pearman Journal of the Chemical Society, 1937 , p. 26,31 |
| N-aminotetrachlorophthalimide |
| 2-amino-4,5,6,7-tetrachloro-isoindole-1,3-dione |
| 2-amino-4,5,6,7-tetrachloro-isoindoline-1,3-dione |
| 2-Amino-4,5,6,7-tetrachlor-isoindolin-1,3-dion |