NSC 311068 structure
|
Common Name | NSC 311068 | ||
|---|---|---|---|---|
| CAS Number | 66474-53-1 | Molecular Weight | 278.24400 | |
| Density | 1.6g/cm3 | Boiling Point | 506.5ºC at 760 mmHg | |
| Molecular Formula | C10H6N4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.1ºC | |
Use of NSC 311068NSC 311068 is a small molecule that directly tragets and inhibits STAT3/5, significantly and selectively suppresses the viability of AML cells with high level of TET1 expression both in vitro and in vivo. |
| Name | 2-(2,4-dinitrophenyl)sulfanylpyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6g/cm3 |
|---|---|
| Boiling Point | 506.5ºC at 760 mmHg |
| Molecular Formula | C10H6N4O4S |
| Molecular Weight | 278.24400 |
| Flash Point | 260.1ºC |
| Exact Mass | 278.01100 |
| PSA | 142.72000 |
| LogP | 3.49060 |
| Index of Refraction | 1.7 |
| InChIKey | UDWLPPBHVNQRBL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Sc2ncccn2)c([N+](=O)[O-])c1 |
|
~77%
NSC 311068 CAS#:66474-53-1 |
| Literature: El-Bardan, Ali A.; Hamed, Ezzat A.; Aboul-Ela, Salah L.; Moussa, Adel M. Journal of the Indian Chemical Society, 1997 , vol. 74, # 7 p. 575 - 578 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Jcc 216 |
| <2,4-Dinitrophenyl>-pyrimidyl-thioaether |
| 1-(pyrimidin-2-ylthio)-2,4-dinitrobenzene |
| 2,4-Dinitropyrimidinyl-2-thiophenol |
| Pyrimidine,2-((2,4-dinitrophenyl)thio) |
| 1-(2'-thiopyrimidine)-2,4-dinitrobenzene |
| HMS2812A16 |