CHEMBRDG-BB 7942794
Modify Date: 2025-09-18 20:42:15
CHEMBRDG-BB 7942794 structure
|
Common Name | CHEMBRDG-BB 7942794 | ||
|---|---|---|---|---|
| CAS Number | 664966-72-7 | Molecular Weight | 215.29400 | |
| Density | 1.07g/cm3 | Boiling Point | 362ºC at 760 mmHg | |
| Molecular Formula | C13H17N3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 172.7ºC | |
| Name | 2-tert-butyl-4-phenylpyrazol-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 362ºC at 760 mmHg |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.29400 |
| Flash Point | 172.7ºC |
| Exact Mass | 215.14200 |
| PSA | 43.84000 |
| LogP | 3.46850 |
| Index of Refraction | 1.577 |
| InChIKey | KVEBAUKFSAFDEN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)n1ncc(-c2ccccc2)c1N |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-tert-butyl-4-phenyl-1h-pyrazol-5-amine |