ethyl 4-(N-methylanilino)-3-oxobutanoate structure
|
Common Name | ethyl 4-(N-methylanilino)-3-oxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 66543-11-1 | Molecular Weight | 235.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4-(N-methylanilino)-3-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H17NO3 |
|---|---|
| Molecular Weight | 235.27900 |
| Exact Mass | 235.12100 |
| PSA | 46.61000 |
| LogP | 1.64510 |
| InChIKey | SDPCAJZDAJFTPT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)CN(C)c1ccccc1 |
|
~92%
ethyl 4-(N-meth... CAS#:66543-11-1 |
| Literature: Zhang, Yinan; Silverman, Richard B. Journal of Organic Chemistry, 2012 , vol. 77, # 7 p. 3462 - 3467 |
|
~%
ethyl 4-(N-meth... CAS#:66543-11-1 |
| Literature: Troostwijk,C.B.; Kellogg,R.M. Journal of the Chemical Society, Chemical Communications, 1977 , p. 932 - 933 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Butanoic acid,4-(methylphenylamino)-3-oxo-,ethyl ester |
| ethyl 4-(methyl(phenyl)amino)-3-oxobutanoate |