5-Phenyl-1H-indole structure
|
Common Name | 5-Phenyl-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 66616-72-6 | Molecular Weight | 193.24400 | |
| Density | 1.156g/cm3 | Boiling Point | 392.547ºC at 760 mmHg | |
| Molecular Formula | C14H11N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.574ºC | |
| Name | 5-phenyl-1h-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.156g/cm3 |
|---|---|
| Boiling Point | 392.547ºC at 760 mmHg |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.24400 |
| Flash Point | 176.574ºC |
| Exact Mass | 193.08900 |
| PSA | 15.79000 |
| LogP | 3.83490 |
| Index of Refraction | 1.679 |
| InChIKey | LPYXADUZSWBHCT-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2ccc3[nH]ccc3c2)cc1 |
| Hazard Codes | C |
|---|---|
| HS Code | 2933990090 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole,5-phenyl |
| 5-phenyl-indole |