2,3-Dimethoxy-5-sulfamoylbenzoic acid structure
|
Common Name | 2,3-Dimethoxy-5-sulfamoylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 66644-80-2 | Molecular Weight | 261.252 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 499.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C9H11NO6S | Melting Point | 206 °C | |
| MSDS | USA | Flash Point | 255.7±31.5 °C | |
| Name | 5-(Aminosulfonyl)-2,3-dimethoxybenzoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 499.2±55.0 °C at 760 mmHg |
| Melting Point | 206 °C |
| Molecular Formula | C9H11NO6S |
| Molecular Weight | 261.252 |
| Flash Point | 255.7±31.5 °C |
| Exact Mass | 261.030701 |
| PSA | 124.30000 |
| LogP | 0.54 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | YEVQOPOKMKTXMD-UHFFFAOYSA-N |
| SMILES | COc1cc(S(N)(=O)=O)cc(C(=O)O)c1OC |
| Hazard Codes | Xn,Xi |
|---|---|
| Risk Phrases | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed . R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36/37-S36/37/39 |
| WGK Germany | 3 |
| HS Code | 29089000 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 2,3-Dimethoxy-5-Sulfamoyl Benzoic Acid |
| 2,3-Dimethoxy-5-sulfamoylbenzoic acid |
| Benzoic acid, 5-(aminosulfonyl)-2,3-dimethoxy- |
| 5-(Aminosulfonyl)-2,3-dimethoxybenzoic Acid |
| MFCD01317561 |
| EINECS 266-433-4 |