5H-pyrido[4,3-b]indole-3-carboxylic acid structure
|
Common Name | 5H-pyrido[4,3-b]indole-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 66646-27-3 | Molecular Weight | 212.20400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5H-pyrido[4,3-b]indole-3-carboxylic acid |
|---|
| Molecular Formula | C12H8N2O2 |
|---|---|
| Molecular Weight | 212.20400 |
| Exact Mass | 212.05900 |
| PSA | 65.98000 |
| LogP | 2.41430 |
| InChIKey | IKPKUJJSUSCALP-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc2[nH]c3ccccc3c2cn1 |
|
~%
5H-pyrido[4,3-b... CAS#:66646-27-3 |
| Literature: Allen; Tan; Trudell; Narayanan; Schindler; Martin; Schultz; Hagen; Koehler; Codding; Skolnick; Cook Journal of Medicinal Chemistry, 1990 , vol. 33, # 9 p. 2343 - 2357 |
|
~%
5H-pyrido[4,3-b... CAS#:66646-27-3 |
| Literature: Allen; Tan; Trudell; Narayanan; Schindler; Martin; Schultz; Hagen; Koehler; Codding; Skolnick; Cook Journal of Medicinal Chemistry, 1990 , vol. 33, # 9 p. 2343 - 2357 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |