ART-CHEM-BB B018034 structure
|
Common Name | ART-CHEM-BB B018034 | ||
|---|---|---|---|---|
| CAS Number | 667412-80-8 | Molecular Weight | 209.31100 | |
| Density | 1.27g/cm3 | Boiling Point | 283.5ºC at 760 mmHg | |
| Molecular Formula | C10H15N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.3ºC | |
| Name | 3-cyclopentyl-4-prop-2-enyl-1H-1,2,4-triazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 283.5ºC at 760 mmHg |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.31100 |
| Flash Point | 125.3ºC |
| Exact Mass | 209.09900 |
| PSA | 69.51000 |
| LogP | 2.41040 |
| Index of Refraction | 1.659 |
| InChIKey | CTVLUILOPVRQHJ-UHFFFAOYSA-N |
| SMILES | C=CCn1c(C2CCCC2)n[nH]c1=S |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-allyl-5-cyclopentyl-4H-1,2,4-triazole-3-thiol |