ART-CHEM-BB B018121
Modify Date: 2025-08-21 10:22:07
ART-CHEM-BB B018121 structure
|
Common Name | ART-CHEM-BB B018121 | ||
|---|---|---|---|---|
| CAS Number | 667414-13-3 | Molecular Weight | 299.75200 | |
| Density | 1.39g/cm3 | Boiling Point | 387.9ºC at 760 mmHg | |
| Molecular Formula | C12H11ClFN3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.4ºC | |
| Name | 3-[(2-chloro-4-fluorophenoxy)methyl]-4-prop-2-enyl-1H-1,2,4-triazole-5-thione |
|---|
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 387.9ºC at 760 mmHg |
| Molecular Formula | C12H11ClFN3OS |
| Molecular Weight | 299.75200 |
| Flash Point | 188.4ºC |
| Exact Mass | 299.03000 |
| PSA | 78.74000 |
| LogP | 3.12430 |
| Index of Refraction | 1.62 |
| InChIKey | RWWUTQVRGTXYJN-UHFFFAOYSA-N |
| SMILES | C=CCn1c(COc2ccc(F)cc2Cl)n[nH]c1=S |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |