3-[(2-chloro-4-fluorophenoxy)methyl]-4-ethyl-1H-1,2,4-triazole-5-thione structure
|
Common Name | 3-[(2-chloro-4-fluorophenoxy)methyl]-4-ethyl-1H-1,2,4-triazole-5-thione | ||
|---|---|---|---|---|
| CAS Number | 667414-15-5 | Molecular Weight | 287.74100 | |
| Density | 1.44g/cm3 | Boiling Point | 374ºC at 760 mmHg | |
| Molecular Formula | C11H11ClFN3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180ºC | |
| Name | 3-[(2-chloro-4-fluorophenoxy)methyl]-4-ethyl-1H-1,2,4-triazole-5-thione |
|---|
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 374ºC at 760 mmHg |
| Molecular Formula | C11H11ClFN3OS |
| Molecular Weight | 287.74100 |
| Flash Point | 180ºC |
| Exact Mass | 287.03000 |
| PSA | 78.74000 |
| LogP | 2.95820 |
| Index of Refraction | 1.632 |
| InChIKey | OIZMNXGLWAGLHD-UHFFFAOYSA-N |
| SMILES | CCn1c(COc2ccc(F)cc2Cl)n[nH]c1=S |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |