AKOS B013950 structure
|
Common Name | AKOS B013950 | ||
|---|---|---|---|---|
| CAS Number | 667436-01-3 | Molecular Weight | 242.69900 | |
| Density | 1.2g/cm3 | Boiling Point | 364.1ºC at 760 mmHg | |
| Molecular Formula | C12H15ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174ºC | |
| Name | 2-(4-chloro-3,5-dimethylphenoxy)-2-methylpropanoic acid |
|---|
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 364.1ºC at 760 mmHg |
| Molecular Formula | C12H15ClO3 |
| Molecular Weight | 242.69900 |
| Flash Point | 174ºC |
| Exact Mass | 242.07100 |
| PSA | 46.53000 |
| LogP | 3.19880 |
| Index of Refraction | 1.534 |
| InChIKey | VMKNHGYEWGGFQL-UHFFFAOYSA-N |
| SMILES | Cc1cc(OC(C)(C)C(=O)O)cc(C)c1Cl |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |