2-[2-[(3-methylphenyl)methylidene]hydrazinyl]-1-phenothiazin-10-ylethanone structure
|
Common Name | 2-[2-[(3-methylphenyl)methylidene]hydrazinyl]-1-phenothiazin-10-ylethanone | ||
|---|---|---|---|---|
| CAS Number | 66762-16-1 | Molecular Weight | 373.47100 | |
| Density | 1.23g/cm3 | Boiling Point | 636.259ºC at 760 mmHg | |
| Molecular Formula | C22H19N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 338.597ºC | |
| Name | 2-[2-[(3-methylphenyl)methylidene]hydrazinyl]-1-phenothiazin-10-ylethanone |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 636.259ºC at 760 mmHg |
| Molecular Formula | C22H19N3OS |
| Molecular Weight | 373.47100 |
| Flash Point | 338.597ºC |
| Exact Mass | 373.12500 |
| PSA | 70.00000 |
| LogP | 5.20390 |
| Index of Refraction | 1.661 |
| InChIKey | RVNNOPPDSUWJRS-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C=NNCC(=O)N2c3ccccc3Sc3ccccc32)c1 |
|
~%
2-[2-[(3-methyl... CAS#:66762-16-1 |
| Literature: Yadav, Ritu; Jain, Vikrant; Srivastava; Srivastava, Soumya Journal of the Indian Chemical Society, 2009 , vol. 86, # 5 p. 537 - 543 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |