2-hydrazinyl-1-phenothiazin-10-ylethanone structure
|
Common Name | 2-hydrazinyl-1-phenothiazin-10-ylethanone | ||
|---|---|---|---|---|
| CAS Number | 54012-74-7 | Molecular Weight | 271.33800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydrazinyl-1-phenothiazin-10-ylethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H13N3OS |
|---|---|
| Molecular Weight | 271.33800 |
| Exact Mass | 271.07800 |
| PSA | 83.66000 |
| LogP | 3.43540 |
| InChIKey | OIIPRDHBDNAXIQ-UHFFFAOYSA-N |
| SMILES | NNCC(=O)N1c2ccccc2Sc2ccccc21 |
|
~87%
2-hydrazinyl-1-... CAS#:54012-74-7 |
| Literature: Salvi, Vijay Kumar; Sharma, Shweta; Sharma, Chirag; Bhambi, Dinesh; Talesara Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2009 , vol. 48, # 11 p. 1583 - 1589 |
|
~%
2-hydrazinyl-1-... CAS#:54012-74-7 |
| Literature: Singh; Ali; Auyong; Parmar; De Boer Journal of Pharmaceutical Sciences, 1976 , vol. 65, # 3 p. 391 - 396 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| 10-(hydrazinoacetyl)-10H-phenothiazine |
| 10-hydrazino acetyl phenothiazine |
| 10-Hydrazinoacetylphenothiazin |
| 10H-Phenothiazine,10-(hydrazinoacetyl) |