WAY-607113 structure
|
Common Name | WAY-607113 | ||
|---|---|---|---|---|
| CAS Number | 667872-22-2 | Molecular Weight | 316.36 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C19H16N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-607113anti-inflammatory and anti-cancer activity |
| Name | WAY-607113 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 |
| Exact Mass | 316.132416 |
| LogP | 2.96 |
| Index of Refraction | 1.678 |
| InChIKey | QIZHUCDHASBYII-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc3ncc(-c4ccccc4)c(N)n3n2)cc1 |
| 2-(4-Methoxyphenyl)-6-phenylpyrazolo[1,5-a]pyrimidin-7-amine |
| Pyrazolo[1,5-a]pyrimidin-7-amine, 2-(4-methoxyphenyl)-6-phenyl- |