Murideoxycholic acid
Modify Date: 2025-08-25 11:53:01
Murideoxycholic acid structure
|
Common Name | Murideoxycholic acid | ||
|---|---|---|---|---|
| CAS Number | 668-49-5 | Molecular Weight | 392.57200 | |
| Density | 1.128g/cm3 | Boiling Point | 547.1ºC at 760 mmHg | |
| Molecular Formula | C24H40O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.8ºC | |
Use of Murideoxycholic acidMurideoxycholic acid is a 6 beta-hydroxylated bile acid[1]. |
| Name | 4-(3,6-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Murideoxycholic acid is a 6 beta-hydroxylated bile acid[1]. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
| Density | 1.128g/cm3 |
|---|---|
| Boiling Point | 547.1ºC at 760 mmHg |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.57200 |
| Flash Point | 298.8ºC |
| Exact Mass | 392.29300 |
| PSA | 77.76000 |
| LogP | 4.47790 |
| Index of Refraction | 1.543 |
| InChIKey | DGABKXLVXPYZII-PLYQRAMGSA-N |
| SMILES | CC(CCC(=O)O)C1CCC2C3CC(O)C4CC(O)CCC4(C)C3CCC12C |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:83-49-8
CAS#:10573-17-8|
Name: Agonist activity at human TGR5 expressed in CHO cells by luciferase assay relative to...
Source: ChEMBL
Target: G-protein coupled bile acid receptor 1
External Id: CHEMBL949257
|
|
Name: Agonist activity at human TGR5 expressed in CHO cells by luciferase assay
Source: ChEMBL
Target: G-protein coupled bile acid receptor 1
External Id: CHEMBL949256
|
Total 2, Current Page 1 of 1
1
| 5beta-Pregnan-20-one,3alpha,6alpha-dihydroxy |
| pregnan-3,6-diol-20-one |
| 3ALPHA,6ALPHA-Dihydroxy-5B-pregnan-20-one |
| Murocholic acid |