1,1,4,6,7-PENTAMETHYLINDAN structure
|
Common Name | 1,1,4,6,7-PENTAMETHYLINDAN | ||
|---|---|---|---|---|
| CAS Number | 6682-67-3 | Molecular Weight | 188.30900 | |
| Density | 0.915g/cm3 | Boiling Point | 250.9ºC at 760 mmHg | |
| Molecular Formula | C14H20 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 100.5ºC | |
| Name | 3,3,4,5,7-pentamethyl-1,2-dihydroindene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.915g/cm3 |
|---|---|
| Boiling Point | 250.9ºC at 760 mmHg |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.30900 |
| Flash Point | 100.5ºC |
| Exact Mass | 188.15700 |
| LogP | 3.83560 |
| Index of Refraction | 1.516 |
| InChIKey | DKEQNICHDTZGAN-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c2c(c1C)C(C)(C)CC2 |
| HS Code | 2902909090 |
|---|
|
~%
1,1,4,6,7-PENTA... CAS#:6682-67-3 |
| Literature: Bansal,R.C. et al. Journal of Organic Chemistry, 1966 , vol. 31, p. 2716 - 2718 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2902909090 |
|---|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
| 1H-Indene,2,3-dihydro-1,1,4,6,7-pentamethyl |
| 1,1,4,6,7-Pentamethylindan |