N-(4,4-diphenyl-6-piperidin-1-ylhexan-3-ylidene)acetamide,hydrochloride structure
|
Common Name | N-(4,4-diphenyl-6-piperidin-1-ylhexan-3-ylidene)acetamide,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 66827-65-4 | Molecular Weight | 412.99500 | |
| Density | N/A | Boiling Point | 531.5ºC at 760 mmHg | |
| Molecular Formula | C25H33ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.3ºC | |
| Name | N-(4,4-diphenyl-6-piperidin-1-ylhexan-3-ylidene)acetamide,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 531.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C25H33ClN2O |
| Molecular Weight | 412.99500 |
| Flash Point | 275.3ºC |
| Exact Mass | 412.22800 |
| PSA | 32.67000 |
| LogP | 5.98610 |
| InChIKey | MLEVADRSELKAOL-UHFFFAOYSA-N |
| SMILES | CCC(=NC(C)=O)C(CCN1CCCCC1)(c1ccccc1)c1ccccc1.Cl |
|
~%
N-(4,4-diphenyl... CAS#:66827-65-4 |
| Literature: Cheney; Smith; Binkley Journal of the American Chemical Society, 1949 , vol. 71, p. 53,55 |
|
~%
N-(4,4-diphenyl... CAS#:66827-65-4 |
| Literature: Cheney; Smith; Binkley Journal of the American Chemical Society, 1949 , vol. 71, p. 53,55 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| LS-9457 |
| 4,4-diphenyl-6-piperidino-hexan-3-on-acetylimine,hydrochloride |
| 4,4-Diphenyl-6-piperidino-hexan-3-on-acetylimin,Hydrochlorid |