halobetasol propionate structure
|
Common Name | halobetasol propionate | ||
|---|---|---|---|---|
| CAS Number | 66852-54-8 | Molecular Weight | 484.96000 | |
| Density | 0.934 g/mL at 25 °C(lit.) | Boiling Point | 55 °C0.3 mm Hg(lit.) | |
| Molecular Formula | C25H31ClF2O5 | Melting Point | -32°C | |
| MSDS | N/A | Flash Point | 185 °F | |
Use of halobetasol propionateHalobetasol propionate is a synthetic corticosteroid for topical dermatological use; exhibits anti-inflammatory, antipruritic, and vasoconstrictive properties. |
| Name | Halobetasol propionate |
|---|---|
| Synonym | More Synonyms |
| Description | Halobetasol propionate is a synthetic corticosteroid for topical dermatological use; exhibits anti-inflammatory, antipruritic, and vasoconstrictive properties. |
|---|---|
| Related Catalog |
| Density | 0.934 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 55 °C0.3 mm Hg(lit.) |
| Melting Point | -32°C |
| Molecular Formula | C25H31ClF2O5 |
| Molecular Weight | 484.96000 |
| Flash Point | 185 °F |
| Exact Mass | 484.18300 |
| PSA | 80.67000 |
| LogP | 4.05110 |
| Index of Refraction | n20/D 1.539(lit.) |
| InChIKey | BDSYKGHYMJNPAB-LICBFIPMSA-N |
| SMILES | CCC(=O)OC1(C(=O)CCl)C(C)CC2C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC21C |
| Storage condition | Refrigerator |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | T |
|---|---|
| Risk Phrases | R22:Harmful if swallowed. R23:Toxic by inhalation. R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36-S45-S7/9 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| RTECS | BY4190000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2937229000 |
| HS Code | 2937229000 |
|---|
| (6S,8S,9R,10S,11S,13S,14S,16S,17R)-17-(chloroacetyl)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-yl propanoate |
| halobetasolpropionate |
| halobetasol 17-propionate |
| (6a,11b,16b)-21-Chloro-6,9-difluoro-11-hydroxy-16-methyl-17-(1-oxopropoxy)pregna-1,4-diene-3,20-dione |
| 21-Chloro-6α,9-difluoro-11β,17-dihydroxy-16β-methylpregna-1,4-diene-3,20-dione 17-propionate |
| Ultravate |
| Uiobetasol Propionate |
| Miracorten |
| Halobetasol |
| ulobetasol propionate |
| propanoate de (6S,8S,9R,10S,11S,13S,14S,16S,17R)-17-(chloroacétyl)-6,9-difluoro-11-hydroxy-10,13,16-triméthyl-3-oxo-6,7,8,9,10,11,12,13,14,15,16,17-dodécahydro-3H-cyclopenta[a]phénanthrén-17-yle |
| (6α,11β,16β)-21-chloro-6,9-difluoro-11-hydroxy-16-methyl-3,20-dioxopregna-1,4-dien-17-yl propanoate |
| (6S,8S,9R,10S,11S,13S,14S,16S,17R)-17-(Chloracetyl)-6,9-difluor-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-ylpropanoat |
| MFCD00866013 |
| 21-Chloro-6a,9-difluoro-11b,17-dihydroxy-16b-methylpregna-1,4-diene-3,20-dione 17-Propionate |
| (6α,11β,16β)-21-Chloro-6,9-difluoro-11-hydroxy-16-methyl-3,20-dioxopregna-1,4-dien-17-yl propionate |
| Halobetasol (propionate) |