N6,N6-Dimethyl-xylo-adenosine structure
|
Common Name | N6,N6-Dimethyl-xylo-adenosine | ||
|---|---|---|---|---|
| CAS Number | 669055-52-1 | Molecular Weight | 295.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N6,N6-Dimethyl-xylo-adenosineN6,N6-Dimethyl-xylo-adenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
| Name | 9-(β-D-xylofuranosyl)-N6,N6-dimethyladenine |
|---|---|
| Synonym | More Synonyms |
| Description | N6,N6-Dimethyl-xylo-adenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C12H17N5O4 |
|---|---|
| Molecular Weight | 295.29 |
| Exact Mass | 295.12800 |
| PSA | 116.76000 |
| InChIKey | WVGPGNPCZPYCLK-IQEPQDSISA-N |
| SMILES | CN(C)c1ncnc2c1ncn2C1OC(CO)C(O)C1O |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| (1R)-1-(6-dimethylamino-purin-9-yl)-D-1,4-anhydro-xylitol |
| (1R)-1-(6-Dimethylamino-purin-9-yl)-D-1,4-anhydro-xylit |